CAS 885521-01-7
:6-Bromo-4-methyl-1H-indazole-3-carboxaldehyde
Description:
6-Bromo-4-methyl-1H-indazole-3-carboxaldehyde is a chemical compound characterized by its indazole core, which is a five-membered heterocyclic structure containing two nitrogen atoms. The presence of a bromine atom at the 6-position and a methyl group at the 4-position contributes to its unique reactivity and properties. The aldehyde functional group at the 3-position makes it a versatile intermediate in organic synthesis, allowing for various chemical transformations. This compound is typically used in research and development, particularly in medicinal chemistry, due to its potential biological activity. It may exhibit properties such as antimicrobial or anticancer effects, although specific biological activities would depend on further empirical studies. Additionally, its solubility and stability can vary based on the solvent and environmental conditions. As with many brominated compounds, it is important to handle it with care due to potential toxicity and environmental concerns. Overall, 6-Bromo-4-methyl-1H-indazole-3-carboxaldehyde is a significant compound in the field of organic chemistry and drug discovery.
Formula:C9H7BrN2O
InChI:InChI=1S/C9H7BrN2O/c1-5-2-6(10)3-7-9(5)8(4-13)12-11-7/h2-4H,1H3,(H,11,12)
InChI key:InChIKey=KJXCFVGXKBJLRY-UHFFFAOYSA-N
SMILES:C(=O)C=1C=2C(NN1)=CC(Br)=CC2C
Synonyms:- 1H-Indazole-3-carboxaldehyde, 6-bromo-4-methyl-
- 6-Bromo-4-methyl-1H-indazole-3-carboxaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.