CAS 885521-05-1
:Methyl 4-amino-3-iodo-1H-indazole-6-carboxylate
Description:
Methyl 4-amino-3-iodo-1H-indazole-6-carboxylate is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of an amino group (-NH2) at the 4-position and an iodo substituent at the 3-position contributes to its reactivity and potential biological activity. The carboxylate group (-COOCH3) at the 6-position indicates that it is a methyl ester, which can influence its solubility and reactivity in various chemical reactions. This compound may exhibit properties such as being a potential intermediate in organic synthesis or having pharmacological significance, given the presence of functional groups that are often associated with bioactivity. Its molecular structure suggests that it could participate in hydrogen bonding and other interactions, making it of interest in medicinal chemistry and drug development. As with many indazole derivatives, it may also exhibit unique optical and electronic properties, which can be explored for various applications in materials science and pharmaceuticals.
Formula:C9H8IN3O2
InChI:InChI=1S/C9H8IN3O2/c1-15-9(14)4-2-5(11)7-6(3-4)12-13-8(7)10/h2-3H,11H2,1H3,(H,12,13)
InChI key:InChIKey=KXKFNOAIRPJUBK-UHFFFAOYSA-N
SMILES:NC1=C2C(=CC(C(OC)=O)=C1)NN=C2I
Synonyms:- Methyl 4-amino-3-iodo-1H-indazole-6-carboxylate
- 1H-Indazole-6-carboxylic acid, 4-amino-3-iodo-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
