CymitQuimica logo

CAS 885521-10-8

:

6-Fluoro-1H-indazol-4-ol

Description:
6-Fluoro-1H-indazol-4-ol is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of a fluorine atom at the 6-position and a hydroxyl group (-OH) at the 4-position contributes to its unique chemical properties. This compound is typically classified as a heterocyclic aromatic compound, exhibiting potential biological activity due to its structural features. It may participate in various chemical reactions, including nucleophilic substitutions and hydrogen bonding, owing to the presence of the hydroxyl group. The fluorine substituent can enhance lipophilicity and influence the compound's interaction with biological targets. 6-Fluoro-1H-indazol-4-ol may be of interest in medicinal chemistry and drug development, particularly in the context of developing therapeutic agents. Its specific applications and biological activities would depend on ongoing research and exploration within the pharmaceutical field.
Formula:C7H5FN2O
InChI:InChI=1S/C7H5FN2O/c8-4-1-6-5(3-9-10-6)7(11)2-4/h1-3,11H,(H,9,10)
InChI key:InChIKey=JIIJFDXTMHKAJH-UHFFFAOYSA-N
SMILES:OC1=C2C(=CC(F)=C1)NN=C2
Synonyms:
  • 6-Fluoro-1H-indazol-4-ol
  • 1H-Indazol-4-ol, 6-fluoro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.