CymitQuimica logo

CAS 885521-11-9

:

3-Bromo-4-nitro-1H-indazole-6-carboxylic acid

Description:
3-Bromo-4-nitro-1H-indazole-6-carboxylic acid is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of a bromine atom at the 3-position and a nitro group at the 4-position contributes to its reactivity and potential applications in various chemical reactions. The carboxylic acid functional group at the 6-position enhances its acidity and solubility in polar solvents, making it useful in organic synthesis and medicinal chemistry. This compound may exhibit biological activity, potentially serving as a lead compound in drug development or as a tool in biochemical research. Its molecular structure allows for various substitution reactions, which can be exploited to create derivatives with tailored properties. As with many halogenated and nitro-substituted compounds, it is essential to handle this substance with care due to potential toxicity and environmental impact.
Formula:C8H4BrN3O4
InChI:InChI=1S/C8H4BrN3O4/c9-7-6-4(10-11-7)1-3(8(13)14)2-5(6)12(15)16/h1-2H,(H,10,11)(H,13,14)
InChI key:InChIKey=XDVGNMVCHCUSLI-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C2C(=CC(C(O)=O)=C1)NN=C2Br
Synonyms:
  • 3-Bromo-4-nitro-1H-indazole-6-carboxylic acid
  • 1H-Indazole-6-carboxylic acid, 3-bromo-4-nitro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.