CAS 885521-32-4
:Methyl 4-amino-3-bromo-1H-indazole-6-carboxylate
Description:
Methyl 4-amino-3-bromo-1H-indazole-6-carboxylate is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of a bromine atom at the 3-position and an amino group at the 4-position contributes to its reactivity and potential biological activity. The carboxylate group at the 6-position, along with the methyl ester functionality, enhances its solubility and may influence its pharmacokinetic properties. This compound is typically used in medicinal chemistry and research due to its potential applications in drug development, particularly in targeting specific biological pathways. Its molecular structure allows for various modifications, making it a versatile scaffold for synthesizing derivatives with enhanced efficacy or selectivity. As with many brominated compounds, it may exhibit unique properties such as increased lipophilicity or altered metabolic stability, which can be critical in the design of therapeutic agents.
Formula:C9H8BrN3O2
InChI:InChI=1S/C9H8BrN3O2/c1-15-9(14)4-2-5(11)7-6(3-4)12-13-8(7)10/h2-3H,11H2,1H3,(H,12,13)
InChI key:InChIKey=OEJSXOICYIJKMI-UHFFFAOYSA-N
SMILES:NC1=C2C(=CC(C(OC)=O)=C1)NN=C2Br
Synonyms:- Methyl 4-amino-3-bromo-1H-indazole-6-carboxylate
- 1H-Indazole-6-carboxylic acid, 4-amino-3-bromo-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
