CAS 885521-50-6

Methyl 4-fluoro-3-formyl-1H-indazole-6-carboxylate

Description:

Methyl 4-fluoro-3-formyl-1H-indazole-6-carboxylate is a chemical compound characterized by its indazole core, which is a five-membered heterocyclic structure containing two nitrogen atoms. The presence of a formyl group (-CHO) at the 3-position and a carboxylate group (-COOCH3) at the 6-position contributes to its reactivity and potential applications in organic synthesis. The fluorine atom at the 4-position can influence the compound's electronic properties and lipophilicity, making it of interest in medicinal chemistry. This compound is typically used in research settings, particularly in the development of pharmaceuticals or agrochemicals, due to its unique structural features that may interact with biological targets. Its molecular structure allows for various functionalization possibilities, which can lead to derivatives with enhanced biological activity. As with many indazole derivatives, it may exhibit interesting pharmacological properties, although specific biological activities would require further investigation. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₁₀H₇FN₂O₃

InChI: InChI=1S/C10H7FN2O3/c1-16-10(15)5-2-6(11)9-7(3-5)12-13-8(9)4-14/h2-4H,1H3,(H,12,13)

InChI key: InChIKey=DSWMSVPMILOVOP-UHFFFAOYSA-N

SMILES: C(=O)C=1C=2C(=CC(C(OC)=O)=CC2F)NN1

Synonyms:

• 1H-Indazole-6-carboxylic acid, 4-fluoro-3-formyl-, methyl ester
• Methyl 4-fluoro-3-formyl-1H-indazole-6-carboxylate