CAS 885521-65-3

3-Bromo-4-fluoro-1H-indazole-6-carboxylic acid

Description:

3-Bromo-4-fluoro-1H-indazole-6-carboxylic acid is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of bromine and fluorine substituents at the 3 and 4 positions, respectively, introduces significant electronegative characteristics, influencing the compound's reactivity and potential applications in medicinal chemistry. The carboxylic acid functional group at the 6 position contributes to its acidity and solubility in polar solvents, making it suitable for various chemical reactions, including esterification and amidation. This compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of new therapeutic agents. Its molecular structure allows for potential interactions with biological targets, and the halogen substituents can enhance lipophilicity and bioavailability. Overall, 3-Bromo-4-fluoro-1H-indazole-6-carboxylic acid is a versatile compound with unique properties that can be leveraged in various chemical and biological applications.

Formula: C₈H₄BrFN₂O₂

InChI: InChI=1S/C8H4BrFN2O2/c9-7-6-4(10)1-3(8(13)14)2-5(6)11-12-7/h1-2H,(H,11,12)(H,13,14)

InChI key: InChIKey=DHVBSFFDJSIDNW-UHFFFAOYSA-N

SMILES: FC1=C2C(=CC(C(O)=O)=C1)NN=C2Br

Synonyms:

• 3-Bromo-4-fluoro-1H-indazole-6-carboxylic acid
• 1H-Indazole-6-carboxylic acid, 3-bromo-4-fluoro-