CymitQuimica logo

CAS 885521-66-4

:

4,6-Dimethyl-1H-indazole-3-carboxaldehyde

Description:
4,6-Dimethyl-1H-indazole-3-carboxaldehyde is an organic compound characterized by its indazole structure, which consists of a five-membered ring containing two nitrogen atoms. This compound features two methyl groups at the 4 and 6 positions of the indazole ring, contributing to its unique chemical properties. The presence of a carboxaldehyde functional group at the 3 position enhances its reactivity, making it useful in various synthetic applications. Typically, this compound is a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure allows for potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the biological activity often associated with indazole derivatives. Additionally, the compound may participate in various chemical reactions, including nucleophilic additions and condensation reactions, making it a versatile building block in organic synthesis. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C10H10N2O
InChI:InChI=1S/C10H10N2O/c1-6-3-7(2)10-8(4-6)11-12-9(10)5-13/h3-5H,1-2H3,(H,11,12)
InChI key:InChIKey=VNDKSFRUCFGLFC-UHFFFAOYSA-N
SMILES:C(=O)C=1C=2C(NN1)=CC(C)=CC2C
Synonyms:
  • 4,6-Dimethyl-1H-indazole-3-carboxaldehyde
  • 1H-Indazole-3-carboxaldehyde, 4,6-dimethyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.