CAS 885521-73-3

4-Fluoro-3-formyl-1H-indazole-6-carboxylic acid

Description:

4-Fluoro-3-formyl-1H-indazole-6-carboxylic acid is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of a formyl group (-CHO) at the 3-position and a carboxylic acid group (-COOH) at the 6-position contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. The fluorine atom at the 4-position can influence the compound's electronic properties and biological activity. This compound may exhibit various functional properties, including potential antimicrobial or anti-inflammatory activities, making it of interest in pharmaceutical research. Its solubility and stability can vary depending on the solvent and pH, which are important factors to consider in experimental applications. Additionally, the compound's structure allows for potential modifications that could enhance its efficacy or selectivity in biological systems. Overall, 4-Fluoro-3-formyl-1H-indazole-6-carboxylic acid represents a versatile scaffold for further chemical exploration and development.

Formula: C₉H₅FN₂O₃

InChI: InChI=1S/C9H5FN2O3/c10-5-1-4(9(14)15)2-6-8(5)7(3-13)12-11-6/h1-3H,(H,11,12)(H,14,15)

InChI key: InChIKey=KWEVCNCUIFAGHP-UHFFFAOYSA-N

SMILES: C(=O)C=1C=2C(=CC(C(O)=O)=CC2F)NN1

Synonyms:

• 4-Fluoro-3-formyl-1H-indazole-6-carboxylic acid
• 1H-Indazole-6-carboxylic acid, 4-fluoro-3-formyl-