CAS 885521-85-7
:1H-Indazole-4-carboxylic acid, 6-fluoro-3-formyl-, methyl ester
Description:
1H-Indazole-4-carboxylic acid, 6-fluoro-3-formyl-, methyl ester is a chemical compound characterized by its indazole core, which is a five-membered heterocyclic structure containing two nitrogen atoms. This compound features a carboxylic acid functional group, a formyl group, and a methyl ester, contributing to its reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of a fluorine atom at the 6-position enhances its biological activity and lipophilicity, which can influence its pharmacokinetic properties. The methyl ester group can facilitate further chemical modifications and improve solubility in organic solvents. This compound may exhibit interesting biological activities, making it a candidate for research in drug development. Its molecular structure allows for various interactions with biological targets, potentially leading to therapeutic applications. As with many indazole derivatives, it may also be studied for its role in various chemical reactions, including coupling reactions and as a building block in the synthesis of more complex molecules.
Formula:C10H7FN2O3
InChI:InChI=1S/C10H7FN2O3/c1-16-10(15)6-2-5(11)3-7-9(6)8(4-14)13-12-7/h2-4H,1H3,(H,12,13)
InChI key:InChIKey=ZRJOWEIEQCKPDG-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=C2C(=CC(F)=C1)NN=C2C=O
Synonyms:- 1H-Indazole-4-carboxylic acid, 6-fluoro-3-formyl-, methyl ester
- Methyl 6-fluoro-3-formyl-1H-indazole-4-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.