CAS 885522-04-3

3-bromo-6-fluoro-1H-indazole

Description:

3-Bromo-6-fluoro-1H-indazole is a heterocyclic organic compound characterized by its indazole core, which consists of a fused benzene and pyrazole ring. The presence of bromine and fluorine substituents at the 3 and 6 positions, respectively, contributes to its unique chemical properties and reactivity. This compound typically exhibits moderate to high lipophilicity due to its aromatic structure, which can influence its solubility in organic solvents. It may also display interesting biological activities, making it a subject of interest in medicinal chemistry and drug development. The presence of halogens can enhance its reactivity in various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, 3-bromo-6-fluoro-1H-indazole may serve as a valuable intermediate in the synthesis of more complex molecules or as a potential pharmacophore in the design of new therapeutic agents. Its stability and reactivity can be influenced by the electronic effects of the halogen substituents, making it a versatile compound in organic synthesis.

Formula: C₇H₄BrFN₂

InChI: InChI=1/C7H4BrFN2/c8-7-5-2-1-4(9)3-6(5)10-11-7/h1-3H,(H,10,11)

SMILES: c1cc2c(cc1F)[nH]nc2Br

Synonyms:

• 1H-indazole, 3-bromo-6-fluoro-

3-BROMO-6-FLUORO (1H)INDAZOLE

CAS: 885522-04-3

Formula: C₇H₄BrFN₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 215.0225

Ref: IN-DA00GVFC

3-Bromo-6-fluoro-1H-indazole

CAS: 885522-04-3

3-Bromo-6-fluoro-1H-indazole

Formula: C₇H₄BrFN₂

Purity: 95%

Color and Shape: white to light yellow solid

Molecular weight: 215.02g/mol

Ref: 54-PC5509

3-Bromo-6-fluoro-1H-indazole

CAS: 885522-04-3

Formula: C₇H₄BrFN₂

Purity: 95%

Color and Shape: Liquid, No data available.

Molecular weight: 215.025

Ref: 10-F223422

3-BROMO-6-FLUORO-1H-INDAZOLE

CAS: 885522-04-3

Purity: 95%

Molecular weight: 215.0249939

Ref: 10-F793381