CAS 885522-05-4
:6-Fluoro-3-iodo-1H-indazole-4-carboxylic acid
Description:
6-Fluoro-3-iodo-1H-indazole-4-carboxylic acid is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of a fluorine atom at the 6-position and an iodine atom at the 3-position contributes to its unique reactivity and potential biological activity. The carboxylic acid functional group at the 4-position enhances its solubility in polar solvents and can participate in various chemical reactions, such as esterification or amidation. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its molecular structure allows for potential interactions with biological targets, which could lead to applications in drug development. Additionally, the halogen substituents can influence the compound's lipophilicity and metabolic stability. As with many halogenated compounds, it is essential to consider safety and environmental impact during handling and disposal.
Formula:C8H4FIN2O2
InChI:InChI=1S/C8H4FIN2O2/c9-3-1-4(8(13)14)6-5(2-3)11-12-7(6)10/h1-2H,(H,11,12)(H,13,14)
InChI key:InChIKey=KXPCPWUPMQWPNO-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C2C(NN=C2I)=CC(F)=C1
Synonyms:- 1H-Indazole-4-carboxylic acid, 6-fluoro-3-iodo-
- 6-Fluoro-3-iodo-1H-indazole-4-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
