CymitQuimica logo

CAS 885522-08-7

:

6-Fluoro-3-formyl-1H-indazole-4-carboxylic acid

Description:
6-Fluoro-3-formyl-1H-indazole-4-carboxylic acid is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of a fluoro group at the 6-position introduces unique electronic and steric properties, potentially influencing its reactivity and biological activity. The formyl group at the 3-position serves as a reactive aldehyde functional group, while the carboxylic acid group at the 4-position contributes to the compound's acidity and solubility in polar solvents. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its structural features suggest potential applications in drug development, particularly in targeting specific biological pathways. Additionally, the presence of both electron-withdrawing and electron-donating groups can affect its interaction with biological targets, influencing its efficacy and selectivity. Overall, 6-Fluoro-3-formyl-1H-indazole-4-carboxylic acid represents a versatile scaffold for further chemical modifications and investigations in various fields of research.
Formula:C9H5FN2O3
InChI:InChI=1S/C9H5FN2O3/c10-4-1-5(9(14)15)8-6(2-4)11-12-7(8)3-13/h1-3H,(H,11,12)(H,14,15)
InChI key:InChIKey=SGKYIHPFVDRZEJ-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C2C(NN=C2C=O)=CC(F)=C1
Synonyms:
  • 1H-Indazole-4-carboxylic acid, 6-fluoro-3-formyl-
  • 6-Fluoro-3-formyl-1H-indazole-4-carboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.