CAS 885522-30-5

Methyl 6-chloro-3-formyl-1H-indazole-4-carboxylate

Description:

Methyl 6-chloro-3-formyl-1H-indazole-4-carboxylate is a chemical compound characterized by its indazole core, which is a five-membered aromatic ring containing two nitrogen atoms. This compound features a chloro substituent at the 6-position and a formyl group at the 3-position, contributing to its reactivity and potential applications in organic synthesis. The presence of a carboxylate ester group at the 4-position enhances its solubility in organic solvents and may influence its biological activity. The methyl ester functionality allows for further derivatization, making it a versatile intermediate in the synthesis of various pharmaceuticals and agrochemicals. Its structure suggests potential interactions with biological targets, which could be explored in medicinal chemistry. The compound's CAS number, 885522-30-5, facilitates its identification in chemical databases, aiding researchers in locating relevant literature and safety data. Overall, Methyl 6-chloro-3-formyl-1H-indazole-4-carboxylate is of interest for its unique structural features and potential applications in chemical research.

Formula: C₁₀H₇ClN₂O₃

InChI: InChI=1S/C10H7ClN2O3/c1-16-10(15)6-2-5(11)3-7-9(6)8(4-14)13-12-7/h2-4H,1H3,(H,12,13)

InChI key: InChIKey=KSMQNCMPFXLFFV-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1=C2C(=CC(Cl)=C1)NN=C2C=O

Synonyms:

• 1H-Indazole-4-carboxylic acid, 6-chloro-3-formyl-, methyl ester
• Methyl 6-chloro-3-formyl-1H-indazole-4-carboxylate