CymitQuimica logo

CAS 885522-40-7

:

4-Methoxy-6-methyl-1H-indazole

Description:
4-Methoxy-6-methyl-1H-indazole is an organic compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of a methoxy group (-OCH3) at the 4-position and a methyl group (-CH3) at the 6-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and is soluble in organic solvents, reflecting its hydrophobic nature due to the aromatic structure. It may exhibit interesting biological activities, making it of interest in medicinal chemistry and drug development. The molecular structure allows for potential interactions with various biological targets, which can be explored in pharmacological studies. Additionally, its stability and reactivity can be influenced by the substituents on the indazole ring, affecting its synthesis and application in various chemical reactions. As with many organic compounds, safety and handling precautions should be observed, particularly in laboratory settings.
Formula:C9H10N2O
InChI:InChI=1S/C9H10N2O/c1-6-3-8-7(5-10-11-8)9(4-6)12-2/h3-5H,1-2H3,(H,10,11)
InChI key:InChIKey=JYMRYDLWCYMQLR-UHFFFAOYSA-N
SMILES:O(C)C1=C2C(=CC(C)=C1)NN=C2
Synonyms:
  • 4-Methoxy-6-methyl-1H-indazole
  • 1H-Indazole, 4-methoxy-6-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.