CAS 885522-48-5
:4-Methoxy-6-methyl-1H-indazole-3-carboxaldehyde
Description:
4-Methoxy-6-methyl-1H-indazole-3-carboxaldehyde is a chemical compound characterized by its indazole core, which is a five-membered heterocyclic structure containing two nitrogen atoms. This compound features a methoxy group (-OCH3) and a methyl group (-CH3) at specific positions on the indazole ring, contributing to its unique chemical properties. The presence of a carboxaldehyde functional group (-CHO) at the 3-position enhances its reactivity, making it suitable for various synthetic applications. The methoxy group can influence the compound's solubility and polarity, while the methyl group may affect its steric hindrance and electronic properties. This compound is of interest in medicinal chemistry and research due to its potential biological activities, although specific applications may vary. Its molecular structure allows for various interactions, making it a candidate for further studies in drug development and organic synthesis. As with many organic compounds, proper handling and safety measures should be observed due to potential toxicity or reactivity.
Formula:C10H10N2O2
InChI:InChI=1S/C10H10N2O2/c1-6-3-7-10(9(4-6)14-2)8(5-13)12-11-7/h3-5H,1-2H3,(H,11,12)
InChI key:InChIKey=MTZFVVBTBJPSBK-UHFFFAOYSA-N
SMILES:O(C)C1=C2C(=CC(C)=C1)NN=C2C=O
Synonyms:- 1H-Indazole-3-carboxaldehyde, 4-methoxy-6-methyl-
- 4-Methoxy-6-methyl-1H-indazole-3-carboxaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
