CAS 885522-53-2
:3-Bromo-4-fluoro-6-methyl-1H-indazole
Description:
3-Bromo-4-fluoro-6-methyl-1H-indazole is a heterocyclic organic compound characterized by its indazole core, which consists of a fused five-membered and six-membered ring containing two nitrogen atoms. The presence of bromine and fluorine substituents at the 3 and 4 positions, respectively, along with a methyl group at the 6 position, contributes to its unique chemical properties and reactivity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of halogen atoms that can enhance biological activity and influence pharmacokinetics. Additionally, the indazole framework is known for its role in various biological activities, making this compound of interest for further research. Safety and handling precautions should be observed, as with many halogenated compounds, due to potential toxicity and environmental impact.
Formula:C8H6BrFN2
InChI:InChI=1S/C8H6BrFN2/c1-4-2-5(10)7-6(3-4)11-12-8(7)9/h2-3H,1H3,(H,11,12)
InChI key:InChIKey=HZIDXVXOJNGYOE-UHFFFAOYSA-N
SMILES:FC1=C2C(=CC(C)=C1)NN=C2Br
Synonyms:- 3-Bromo-4-fluoro-6-methyl-1H-indazole
- 1H-Indazole, 3-bromo-4-fluoro-6-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
