CAS 885522-57-6
:6-Fluoro-4-methoxy-1H-indazole
Description:
6-Fluoro-4-methoxy-1H-indazole is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of a fluorine atom at the 6-position and a methoxy group at the 4-position contributes to its unique chemical properties and potential biological activity. This compound is typically classified as a heterocyclic aromatic compound, which may exhibit various pharmacological effects, making it of interest in medicinal chemistry. Its molecular structure suggests that it may participate in hydrogen bonding and exhibit lipophilicity due to the methoxy group, influencing its solubility and permeability in biological systems. The compound's CAS number, 885522-57-6, allows for its identification in chemical databases and literature. As with many indazole derivatives, it may be investigated for applications in drug development, particularly in areas such as oncology or neurology, although specific biological activities would require empirical studies to elucidate its mechanisms of action and therapeutic potential.
Formula:C8H7FN2O
InChI:InChI=1S/C8H7FN2O/c1-12-8-3-5(9)2-7-6(8)4-10-11-7/h2-4H,1H3,(H,10,11)
InChI key:InChIKey=UDCNOKLYDDTYFZ-UHFFFAOYSA-N
SMILES:O(C)C1=C2C(=CC(F)=C1)NN=C2
Synonyms:- 1H-Indazole, 6-fluoro-4-methoxy-
- 6-Fluoro-4-methoxy-1H-indazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
