CymitQuimica logo

CAS 885522-60-1

:

6-Methyl 1H-indazole-3,6-dicarboxylate

Description:
6-Methyl 1H-indazole-3,6-dicarboxylate is a chemical compound characterized by its indazole core, which is a five-membered aromatic ring containing two nitrogen atoms. This compound features two carboxylate groups (-COO-) at the 3 and 6 positions of the indazole ring, contributing to its acidic properties and potential for forming salts or esters. The presence of a methyl group at the 6 position enhances its lipophilicity and may influence its biological activity. Typically, compounds like this are of interest in medicinal chemistry and drug development due to their potential pharmacological properties. The molecular structure allows for various functionalizations, making it versatile for synthetic applications. Additionally, the compound may exhibit specific reactivity patterns typical of dicarboxylates, such as undergoing esterification or participating in condensation reactions. Its CAS number, 885522-60-1, provides a unique identifier for regulatory and safety information, facilitating its use in research and industrial applications.
Formula:C10H8N2O4
InChI:InChI=1S/C10H8N2O4/c1-16-10(15)5-2-3-6-7(4-5)11-12-8(6)9(13)14/h2-4H,1H3,(H,11,12)(H,13,14)
InChI key:InChIKey=AZTKLZPDTBASOO-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=2C(=CC(C(OC)=O)=CC2)NN1
Synonyms:
  • 1H-Indazole-3,6-dicarboxylic acid, 6-methyl ester
  • 6-Methyl 1H-indazole-3,6-dicarboxylate
Found 5 products.