CAS 885522-69-0
:3,6-Dichloro-4-nitro-1H-indazole
Description:
3,6-Dichloro-4-nitro-1H-indazole is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of two chlorine atoms at the 3 and 6 positions, along with a nitro group at the 4 position, contributes to its unique reactivity and properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its chlorinated and nitro substituents can influence its electronic properties, making it potentially useful in various chemical applications, including as a building block in organic synthesis or in the development of pharmaceuticals. The compound's molecular structure suggests it may participate in electrophilic aromatic substitution reactions and could serve as a precursor for further chemical modifications. Safety data should be consulted, as halogenated compounds can pose environmental and health risks.
Formula:C7H3Cl2N3O2
InChI:InChI=1S/C7H3Cl2N3O2/c8-3-1-4-6(7(9)11-10-4)5(2-3)12(13)14/h1-2H,(H,10,11)
InChI key:InChIKey=XIWKZNOAASZIJT-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C2C(NN=C2Cl)=CC(Cl)=C1
Synonyms:- 3,6-Dichloro-4-nitro-1H-indazole
- 1H-Indazole, 3,6-dichloro-4-nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
