CymitQuimica logo

CAS 885522-72-5

:

3,6-Dichloro-1H-indazol-4-amine

Description:
3,6-Dichloro-1H-indazol-4-amine is a chemical compound characterized by its indazole core, which is a five-membered heterocyclic structure containing two nitrogen atoms. The presence of two chlorine atoms at the 3 and 6 positions of the indazole ring contributes to its unique reactivity and potential biological activity. The amine group at the 4-position enhances its solubility in polar solvents and may influence its interaction with biological targets. This compound is often studied for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to modulate various biological pathways. Its molecular structure allows for various substitution patterns, which can be explored to optimize its pharmacological properties. Additionally, the compound's stability, solubility, and reactivity can be influenced by the presence of the chlorine substituents, making it a subject of interest in both synthetic and medicinal chemistry research. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C7H5Cl2N3
InChI:InChI=1S/C7H5Cl2N3/c8-3-1-4(10)6-5(2-3)11-12-7(6)9/h1-2H,10H2,(H,11,12)
InChI key:InChIKey=JRXMADLFFOBMOJ-UHFFFAOYSA-N
SMILES:NC1=C2C(=CC(Cl)=C1)NN=C2Cl
Synonyms:
  • 3,6-Dichloro-1H-indazol-4-amine
  • 1H-Indazol-4-amine, 3,6-dichloro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.