CAS 885523-08-0

6-Bromo-1H-indazole-4-carboxylic acid

Description:

6-Bromo-1H-indazole-4-carboxylic acid is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of a bromine atom at the 6-position and a carboxylic acid functional group at the 4-position contributes to its unique reactivity and properties. This compound typically appears as a solid at room temperature and is soluble in polar solvents, which is common for carboxylic acids. It may exhibit acidic behavior due to the carboxylic group, allowing it to participate in various chemical reactions, such as esterification or amidation. The bromine substituent can also influence the compound's reactivity, making it a potential candidate for further functionalization in synthetic organic chemistry. Additionally, compounds like 6-Bromo-1H-indazole-4-carboxylic acid may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to their biological activity and ability to interact with various biological targets.

Formula: C₈H₅BrN₂O₂

InChI: InChI=1S/C8H5BrN2O2/c9-4-1-5(8(12)13)6-3-10-11-7(6)2-4/h1-3H,(H,10,11)(H,12,13)

InChI key: InChIKey=YYONCBWTWPVWRT-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C2C(=CC(Br)=C1)NN=C2

Synonyms:

• 1H-Indazole-4-carboxylic acid, 6-bromo-
• 6-Bromo-1H-indazole-4-carboxylic acid
• 6-Bromoindazole-4-carboxylic acid

6-bromo-1H-indazole-4-carboxylic acid

CAS: 885523-08-0

Formula: C₈H₅BrN₂O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 241.0415

Ref: IN-DA003N3I

6-Bromo-1H-indazole-4-carboxylic acid

CAS: 885523-08-0

6-Bromo-1H-indazole-4-carboxylic acid

Formula: C₈H₅BrN₂O₂

Purity: ≥95%

Color and Shape: faint beige/brown solid

Molecular weight: 241.04g/mol

Ref: 54-OR301140