CymitQuimica logo

CAS 885523-22-8

:

4-Chloro-3-formyl-1H-indazole-6-carboxylic acid

Description:
4-Chloro-3-formyl-1H-indazole-6-carboxylic acid is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. This compound features a formyl group (-CHO) and a carboxylic acid group (-COOH) at specific positions on the indazole ring, along with a chlorine atom substituent. The presence of these functional groups contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. The carboxylic acid group can participate in various reactions, such as esterification and amidation, while the formyl group can be involved in condensation reactions. The chlorine atom may influence the compound's electronic properties and reactivity. Overall, 4-Chloro-3-formyl-1H-indazole-6-carboxylic acid is of interest for its potential use in the development of pharmaceuticals and agrochemicals, as well as in research settings for the synthesis of more complex molecules.
Formula:C9H5ClN2O3
InChI:InChI=1S/C9H5ClN2O3/c10-5-1-4(9(14)15)2-6-8(5)7(3-13)12-11-6/h1-3H,(H,11,12)(H,14,15)
InChI key:InChIKey=JUSOWVCMDYFTQQ-UHFFFAOYSA-N
SMILES:C(=O)C=1C=2C(=CC(C(O)=O)=CC2Cl)NN1
Synonyms:
  • 1H-Indazole-6-carboxylic acid, 4-chloro-3-formyl-
  • 4-Chloro-3-formyl-1H-indazole-6-carboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.