CAS 885523-72-8
:6-Bromo-3-chloro-1H-indazole-4-carboxylic acid
Description:
6-Bromo-3-chloro-1H-indazole-4-carboxylic acid is a heterocyclic organic compound characterized by its indazole core, which features both bromine and chlorine substituents. The presence of the carboxylic acid functional group indicates that it can participate in acid-base reactions and may exhibit acidic properties. This compound is typically used in pharmaceutical research and development due to its potential biological activity. The bromine and chlorine atoms contribute to its reactivity and may influence its interaction with biological targets. Additionally, the indazole structure is known for its role in various medicinal chemistry applications, including anti-inflammatory and anticancer activities. The compound's solubility, stability, and reactivity can vary based on environmental conditions and the presence of other functional groups. Overall, 6-Bromo-3-chloro-1H-indazole-4-carboxylic acid represents a valuable scaffold in the synthesis of novel therapeutic agents.
Formula:C8H4BrClN2O2
InChI:InChI=1S/C8H4BrClN2O2/c9-3-1-4(8(13)14)6-5(2-3)11-12-7(6)10/h1-2H,(H,11,12)(H,13,14)
InChI key:InChIKey=XPUOIHIXXKAOFI-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C2C(NN=C2Cl)=CC(Br)=C1
Synonyms:- 1H-Indazole-4-carboxylic acid, 6-bromo-3-chloro-
- 6-Bromo-3-chloro-1H-indazole-4-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
