CAS 885524-05-0

Methyl 1,2,3,4-tetrahydro-7-methyl-4-oxo-2-thioxopyrido[2,3-d]pyrimidine-5-carboxylate

Description:

Methyl 1,2,3,4-tetrahydro-7-methyl-4-oxo-2-thioxopyrido[2,3-d]pyrimidine-5-carboxylate is a complex organic compound characterized by its unique bicyclic structure, which incorporates both pyridine and pyrimidine rings. This substance features a tetrahydro configuration, indicating the presence of a saturated ring system, and includes a thioxo group, which contributes to its reactivity and potential biological activity. The presence of a methyl group and a carboxylate ester further enhances its chemical properties, making it a candidate for various applications in medicinal chemistry. The compound's structure suggests potential interactions with biological targets, which may lead to pharmacological effects. Additionally, its molecular characteristics may influence solubility, stability, and reactivity, making it of interest for further research in drug development and synthesis. As with many complex organic molecules, understanding its behavior in different environments is crucial for assessing its utility in various chemical and biological contexts.

Formula: C₁₀H₉N₃O₃S

InChI: InChI=1S/C10H9N3O3S/c1-4-3-5(9(15)16-2)6-7(11-4)12-10(17)13-8(6)14/h3H,1-2H3,(H2,11,12,13,14,17)

InChI key: InChIKey=RRZACLOGHOJTKS-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1=C2C(NC(=S)NC2=O)=NC(C)=C1

Synonyms:

• Methyl 1,2,3,4-tetrahydro-7-methyl-4-oxo-2-thioxopyrido[2,3-d]pyrimidine-5-carboxylate
• Pyrido[2,3-d]pyrimidine-5-carboxylic acid, 1,2,3,4-tetrahydro-7-methyl-4-oxo-2-thioxo-, methyl ester