CymitQuimica logo

CAS 88553-90-6

:

4-(2-Bromo-1,1,2-trifluoroethoxy)-2-chlorophenol

Description:
4-(2-Bromo-1,1,2-trifluoroethoxy)-2-chlorophenol, with the CAS number 88553-90-6, is an organic compound characterized by its complex structure, which includes a phenolic group, a bromine atom, and a trifluoroethoxy substituent. This compound typically exhibits properties associated with halogenated phenols, such as moderate to high lipophilicity and potential biological activity. The presence of the trifluoroethoxy group can enhance its stability and influence its reactivity, making it of interest in various chemical applications, including pharmaceuticals and agrochemicals. The bromine and chlorine substituents can also impart unique electronic properties, affecting the compound's interaction with biological systems. Additionally, due to the presence of halogens, this compound may exhibit specific environmental persistence and toxicity characteristics, necessitating careful handling and assessment in both laboratory and industrial settings. Overall, 4-(2-Bromo-1,1,2-trifluoroethoxy)-2-chlorophenol represents a class of compounds that are valuable for their diverse chemical behavior and potential applications.
Formula:C8H5BrClF3O2
InChI:InChI=1S/C8H5BrClF3O2/c9-7(11)8(12,13)15-4-1-2-6(14)5(10)3-4/h1-3,7,14H
InChI key:InChIKey=TYXSFRCWNNFGTN-UHFFFAOYSA-N
SMILES:O(C(C(Br)F)(F)F)C1=CC(Cl)=C(O)C=C1
Synonyms:
  • 4-(2-Bromo-1,1,2-trifluoroethoxy)-2-chlorophenol
  • Phenol, 4-(2-bromo-1,1,2-trifluoroethoxy)-2-chloro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.