CAS 885532-14-9

6-(Aminosulfonyl)-3,4-dihydro-2H-1-benzopyran-3-carboxylic acid

Description:

6-(Aminosulfonyl)-3,4-dihydro-2H-1-benzopyran-3-carboxylic acid, with the CAS number 885532-14-9, is a chemical compound characterized by its unique structural features, which include a benzopyran core and an aminosulfonyl group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential biological activity. The presence of the carboxylic acid functional group suggests it can participate in acid-base reactions, while the aminosulfonyl moiety may enhance its solubility in polar solvents and influence its interaction with biological targets. The dihydrobenzopyran structure indicates that it may possess antioxidant properties, and its potential applications could span pharmaceuticals, particularly in the development of drugs targeting various diseases. Additionally, the compound's stability, reactivity, and solubility can be influenced by environmental factors such as pH and temperature, making it a subject of interest in medicinal chemistry and drug design.

Formula: C₁₀H₁₁NO₅S

InChI: InChI=1S/C10H11NO5S/c11-17(14,15)8-1-2-9-6(4-8)3-7(5-16-9)10(12)13/h1-2,4,7H,3,5H2,(H,12,13)(H2,11,14,15)

InChI key: InChIKey=JPLWTCNEAYJRLQ-UHFFFAOYSA-N

SMILES: S(N)(=O)(=O)C=1C=C2C(=CC1)OCC(C(O)=O)C2

Synonyms:

• 2H-1-Benzopyran-3-carboxylic acid, 6-(aminosulfonyl)-3,4-dihydro-
• 6-(Aminosulfonyl)-3,4-dihydro-2H-1-benzopyran-3-carboxylic acid

6-Sulfamoyl-3,4-dihydro-2H-1-benzopyran-3-carboxylic acid

CAS: 885532-14-9

Versatile small molecule scaffold

Formula: C₁₀H₁₁NO₅S

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 257.27 g/mol

Ref: 3D-KKB53214