CymitQuimica logo

CAS 885532-46-7

:

1-(3-Bromo-5-chloro-2-methoxyphenyl)ethanone

Description:
1-(3-Bromo-5-chloro-2-methoxyphenyl)ethanone, with the CAS number 885532-46-7, is an organic compound characterized by its aromatic structure and functional groups. It features a phenyl ring substituted with a bromine atom, a chlorine atom, and a methoxy group, which contribute to its chemical reactivity and physical properties. The ethanone moiety indicates the presence of a ketone functional group, which is known for its ability to participate in various chemical reactions, such as nucleophilic additions. The presence of halogens (bromine and chlorine) can enhance the compound's reactivity and influence its biological activity. This compound may exhibit interesting properties such as solubility in organic solvents and potential applications in pharmaceuticals or agrochemicals due to its unique structural features. Additionally, the methoxy group can affect the electronic properties of the molecule, potentially influencing its interaction with biological targets. Overall, this compound represents a complex structure that may be of interest in synthetic organic chemistry and medicinal chemistry research.
Formula:C9H8BrClO2
InChI:InChI=1S/C9H8BrClO2/c1-5(12)7-3-6(11)4-8(10)9(7)13-2/h3-4H,1-2H3
InChI key:InChIKey=AIWXRHAEGDRXGS-UHFFFAOYSA-N
SMILES:O(C)C1=C(C(C)=O)C=C(Cl)C=C1Br
Synonyms:
  • Ethanone, 1-(3-bromo-5-chloro-2-methoxyphenyl)-
  • 1-(3-Bromo-5-chloro-2-methoxyphenyl)ethan-1-one
  • 1-(3-Bromo-5-chloro-2-methoxyphenyl)ethanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.