CAS 88559-57-3
:9-Methyl-8-oxa-1,4-dithiaspiro[4.5]decan-7-one
Description:
9-Methyl-8-oxa-1,4-dithiaspiro[4.5]decan-7-one is a heterocyclic compound characterized by its unique spirocyclic structure, which incorporates both sulfur and oxygen atoms within its framework. The presence of a methyl group contributes to its overall stability and influences its reactivity. This compound features a seven-membered carbonyl-containing ring, which is indicative of its potential as a reactive intermediate in various chemical reactions. The inclusion of sulfur atoms in the structure suggests that it may exhibit properties typical of thioethers or thioketones, potentially impacting its solubility and interaction with other chemical species. Additionally, the compound's spiro configuration can lead to interesting stereochemical properties, which may affect its biological activity and applications in medicinal chemistry. While specific physical properties such as melting point, boiling point, and solubility are not detailed here, compounds of this nature often exhibit unique reactivity patterns that can be exploited in synthetic organic chemistry. Overall, 9-Methyl-8-oxa-1,4-dithiaspiro[4.5]decan-7-one represents a fascinating area of study within the realm of heterocyclic chemistry.
Formula:C8H12O2S2
InChI:InChI=1S/C8H12O2S2/c1-6-4-8(5-7(9)10-6)11-2-3-12-8/h6H,2-5H2,1H3
InChI key:InChIKey=CRVVPRDLYJRFBW-UHFFFAOYSA-N
SMILES:CC1CC2(CC(=O)O1)SCCS2
Synonyms:- 9-Methyl-8-oxa-1,4-dithiaspiro[4.5]decan-7-one
- 8-Oxa-1,4-dithiaspiro[4.5]decan-7-one, 9-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
