CymitQuimica logo

CAS 88561-91-5

:

Pyrazolo[1,5-b]pyridazine-3-carboxylic acid

Description:
Pyrazolo[1,5-b]pyridazine-3-carboxylic acid is a heterocyclic organic compound characterized by its unique bicyclic structure, which consists of a pyrazole ring fused to a pyridazine ring. This compound features a carboxylic acid functional group at the 3-position of the pyridazine moiety, contributing to its acidic properties. It is typically a crystalline solid and may exhibit moderate solubility in polar solvents due to the presence of the carboxylic acid group. The compound is of interest in medicinal chemistry and research due to its potential biological activities, including anti-inflammatory and anticancer properties. Its molecular structure allows for various chemical modifications, which can enhance its pharmacological profile. Additionally, the presence of nitrogen atoms in the rings can influence its reactivity and interaction with biological targets. As with many heterocycles, the compound's properties, such as melting point, boiling point, and spectral characteristics, can vary based on purity and environmental conditions.
Formula:C7H5N3O2
InChI:InChI=1S/C7H5N3O2/c11-7(12)5-4-9-10-6(5)2-1-3-8-10/h1-4H,(H,11,12)
InChI key:ZYPYCOBBCUKALX-UHFFFAOYSA-N
SMILES:C1=CC2=C(C=NN2N=C1)C(=O)O
Synonyms:
  • Pyrazolo[1,5-b]pyridazine-3-carboxylicacid
Found 5 products.