CAS 88561-92-6
:Pyrazolo[1,5-b]pyridazine, 2-(2-furanyl)-
Description:
Pyrazolo[1,5-b]pyridazine, 2-(2-furanyl)-, identified by the CAS number 88561-92-6, is a heterocyclic compound featuring a fused pyrazolo and pyridazine ring system, along with a furan substituent. This compound exhibits a unique structural arrangement that contributes to its potential biological activity and chemical reactivity. Typically, compounds of this class may demonstrate properties such as anti-inflammatory, analgesic, or antimicrobial effects, although specific biological activities can vary based on the substituents and the overall molecular structure. The presence of the furan moiety can enhance the compound's lipophilicity and influence its interaction with biological targets. Pyrazolo[1,5-b]pyridazines are of interest in medicinal chemistry for their potential applications in drug development. Additionally, the compound's stability, solubility, and reactivity can be influenced by environmental factors such as pH and temperature. As with many heterocycles, the synthesis and characterization of this compound are crucial for understanding its properties and potential applications in various fields, including pharmaceuticals and agrochemicals.
Formula:C10H7N3O
InChI:InChI=1S/C10H7N3O/c1-3-8-7-9(10-4-2-6-14-10)12-13(8)11-5-1/h1-7H
InChI key:InChIKey=XTMWYWWFKZHDPW-UHFFFAOYSA-N
SMILES:C=1(C=C2N(N1)N=CC=C2)C3=CC=CO3
Synonyms:- 2-(Furan-2-yl)pyrazolo[1,5-b]pyridazine
- Pyrazolo[1,5-b]pyridazine, 2-(2-furanyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
