CymitQuimica logo

CAS 88562-42-9

:

1,1,1,2,5,6,6,6-Octafluoro-3-iodo-2,5-bis(trifluoromethyl)hexane

Description:
1,1,1,2,5,6,6,6-Octafluoro-3-iodo-2,5-bis(trifluoromethyl)hexane, with CAS number 88562-42-9, is a fluorinated organic compound characterized by its complex structure featuring multiple fluorine and iodine substituents. This compound is part of a class of perfluorinated compounds known for their unique chemical stability and low reactivity due to the strong carbon-fluorine bonds. It exhibits high thermal and chemical stability, making it resistant to degradation in various environmental conditions. The presence of iodine in its structure may impart specific reactivity, particularly in nucleophilic substitution reactions. Additionally, the trifluoromethyl groups contribute to its lipophilicity and potential applications in various fields, including pharmaceuticals and materials science. However, the environmental impact and bioaccumulation potential of such fluorinated compounds are subjects of ongoing research, given the concerns surrounding perfluorinated substances. Overall, this compound's unique properties make it of interest in both industrial applications and scientific research, particularly in the development of new materials and chemical processes.
Formula:C8H3F14I
InChI:InChI=1S/C8H3F14I/c9-3(5(11,12)13,6(14,15)16)1-2(23)4(10,7(17,18)19)8(20,21)22/h2H,1H2
InChI key:InChIKey=ZSSJJRCCIXTXHJ-UHFFFAOYSA-N
SMILES:C(C(CC(C(F)(F)F)(C(F)(F)F)F)I)(C(F)(F)F)(C(F)(F)F)F
Synonyms:
  • Hexane, 1,1,1,2,5,6,6,6-octafluoro-3-iodo-2,5-bis(trifluoromethyl)-
  • 1,1,1,2,5,6,6,6-Octafluoro-3-iodo-2,5-bis(trifluoromethyl)hexane
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.