CAS 885653-42-9

4-(Phenylmethyl)-4-piperidinamine

Description:

4-(Phenylmethyl)-4-piperidinamine, also known by its CAS number 885653-42-9, is a chemical compound characterized by its piperidine structure, which features a six-membered ring containing one nitrogen atom. This compound has a phenylmethyl group attached to the piperidine nitrogen, contributing to its unique properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of the amine functional group suggests that it can participate in hydrogen bonding, influencing its reactivity and interaction with other molecules. This compound may be of interest in medicinal chemistry due to its potential biological activity, particularly in the development of pharmaceuticals targeting various neurological or psychological conditions. Its specific characteristics, such as melting point, boiling point, and spectral data, would require empirical measurement or literature reference for precise values. As with many amines, it may also be sensitive to oxidation and can react with acids to form salts. Safety data should be consulted for handling and storage guidelines.

Formula: C₁₂H₁₈N₂

InChI: InChI=1S/C12H18N2/c13-12(6-8-14-9-7-12)10-11-4-2-1-3-5-11/h1-5,14H,6-10,13H2

InChI key: InChIKey=ASIJJQPHUXEBMG-UHFFFAOYSA-N

SMILES: C(C1(N)CCNCC1)C2=CC=CC=C2

Synonyms:

• 4-Piperidinamine, 4-(phenylmethyl)-
• 4-(Phenylmethyl)-4-piperidinamine

4-Benzylpiperidin-4-amine

CAS: 885653-42-9

Formula: C₁₂H₁₈N₂

Molecular weight: 190.2847

Ref: IN-DA004BXI