CAS 88566-75-0
:1-(4-chlorophenoxy)-3,3-dimethyl-1-(1H-1,2,4-triazol-1-yl)butan-2-ol - 1-[2-(2,4-dichlorophenyl)-2-(prop-2-en-1-yloxy)ethyl]-1H-imidazole (1:1)
Description:
The chemical substance known as "1-(4-chlorophenoxy)-3,3-dimethyl-1-(1H-1,2,4-triazol-1-yl)butan-2-ol - 1-[2-(2,4-dichlorophenyl)-2-(prop-2-en-1-yloxy)ethyl]-1H-imidazole (1:1)" with CAS number 88566-75-0 is a complex organic compound that exhibits characteristics typical of both triazole and imidazole derivatives. It is likely to possess fungicidal or herbicidal properties, given the presence of chlorophenyl and triazole moieties, which are often associated with agricultural applications. The compound's structure suggests it may interact with biological systems, potentially inhibiting specific enzymes or pathways. Its solubility, stability, and reactivity would depend on the functional groups present, particularly the chlorinated aromatic rings and the alkoxy substituents. Additionally, the presence of multiple functional groups indicates that it may exhibit diverse biological activities, making it of interest in both pharmaceutical and agrochemical research. Safety and handling precautions would be necessary due to the potential toxicity associated with chlorinated compounds.
Formula:C28H32Cl3N5O3
InChI:InChI=1/C14H14Cl2N2O.C14H18ClN3O2/c1-2-7-19-14(9-18-6-5-17-10-18)12-4-3-11(15)8-13(12)16;1-14(2,3)12(19)13(18-9-16-8-17-18)20-11-6-4-10(15)5-7-11/h2-6,8,10,14H,1,7,9H2;4-9,12-13,19H,1-3H3
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
