CAS 88568-73-4

5-[(3-Chlorophenyl)methylene]-3-methyl-2-thioxo-4-imidazolidinone

Description:

5-[(3-Chlorophenyl)methylene]-3-methyl-2-thioxo-4-imidazolidinone, with the CAS number 88568-73-4, is a synthetic organic compound characterized by its imidazolidinone core structure, which features a thioxo group and a substituted phenyl ring. This compound typically exhibits properties such as moderate solubility in organic solvents and limited solubility in water, which is common for many imidazolidinone derivatives. The presence of the 3-chlorophenyl group contributes to its potential biological activity, possibly influencing its interaction with biological targets. The thioxo group may impart unique reactivity, making it of interest in medicinal chemistry and drug development. Additionally, compounds of this class may exhibit various pharmacological properties, including antimicrobial or anti-inflammatory activities, although specific biological data would depend on empirical studies. Overall, this compound represents a class of heterocyclic compounds that are valuable in research and potential therapeutic applications.

Formula: C₁₁H₉ClN₂OS

InChI: InChI=1S/C11H9ClN2OS/c1-14-10(15)9(13-11(14)16)6-7-3-2-4-8(12)5-7/h2-6H,1H3,(H,13,16)

InChI key: InChIKey=LJJJAKWVDYYWTJ-UHFFFAOYSA-N

SMILES: C(=C1C(=O)N(C)C(=S)N1)C2=CC(Cl)=CC=C2

Synonyms:

• 5-[(3-Chlorophenyl)methylene]-3-methyl-2-thioxo-4-imidazolidinone
• 4-Imidazolidinone, 5-[(3-chlorophenyl)methylene]-3-methyl-2-thioxo-

4-Imidazolidinone, 5-[(3-chlorophenyl)methylene]-3-methyl-2-thioxo-

CAS: 88568-73-4

Formula: C₁₁H₉ClN₂OS

Molecular weight: 252.72

Ref: IN-DA004BT9