CAS 885681-46-9

Ethyl 2-(4-methoxyphenyl)-5-thiazoleacetate

Description:

Ethyl 2-(4-methoxyphenyl)-5-thiazoleacetate is an organic compound characterized by its thiazole and aromatic functionalities. It features a thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen, contributing to its unique chemical properties. The presence of the ethyl ester group enhances its solubility in organic solvents, making it suitable for various applications in organic synthesis and medicinal chemistry. The 4-methoxyphenyl substituent introduces an electron-donating methoxy group, which can influence the compound's reactivity and biological activity. This compound may exhibit interesting pharmacological properties, potentially acting as a lead compound in drug discovery. Its molecular structure allows for various interactions, including hydrogen bonding and π-π stacking, which can be significant in biological systems. As with many thiazole derivatives, it may also possess antimicrobial or anti-inflammatory properties, although specific biological activities would require further investigation. Overall, Ethyl 2-(4-methoxyphenyl)-5-thiazoleacetate represents a versatile scaffold in organic chemistry with potential applications in pharmaceuticals.

Formula: C₁₄H₁₅NO₃S

InChI: InChI=1S/C14H15NO3S/c1-3-18-13(16)8-12-9-15-14(19-12)10-4-6-11(17-2)7-5-10/h4-7,9H,3,8H2,1-2H3

InChI key: InChIKey=QQTPTPPOZXLLNT-UHFFFAOYSA-N

SMILES: C(C(OCC)=O)C=1SC(=NC1)C2=CC=C(OC)C=C2

Synonyms:

• 5-Thiazoleacetic acid, 2-(4-methoxyphenyl)-, ethyl ester
• Ethyl 2-(4-methoxyphenyl)-5-thiazoleacetate
• Ethyl [2-(4-methoxyphenyl)-1,3-thiazol-5-yl]acetate
• Ethyl 2-(2-(4-methoxyphenyl)thiazol-5-yl)acetate