CAS 885681-97-0

Methyl 4-bromo-2-iodobenzeneacetate

Description:

Methyl 4-bromo-2-iodobenzeneacetate is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with both bromine and iodine atoms, as well as an ester functional group. The presence of the bromine and iodine substituents contributes to its reactivity and potential applications in various chemical reactions, such as nucleophilic substitutions or coupling reactions. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is soluble in organic solvents, which makes it useful in organic synthesis and medicinal chemistry. The ester group in its structure suggests that it may undergo hydrolysis in the presence of water or bases, leading to the formation of the corresponding acid and alcohol. Safety precautions should be taken when handling this compound, as halogenated compounds can pose health risks and environmental concerns. Overall, Methyl 4-bromo-2-iodobenzeneacetate serves as a valuable intermediate in the synthesis of more complex organic molecules.

Formula: C₉H₈BrIO₂

InChI: InChI=1S/C9H8BrIO2/c1-13-9(12)4-6-2-3-7(10)5-8(6)11/h2-3,5H,4H2,1H3

InChI key: InChIKey=IFJFTXNNXWJBMR-UHFFFAOYSA-N

SMILES: C(C(OC)=O)C1=C(I)C=C(Br)C=C1

Synonyms:

• Methyl 4-bromo-2-iodobenzeneacetate
• Benzeneacetic acid, 4-bromo-2-iodo-, methyl ester
• Methyl (4-bromo-2-iodophenyl)acetate