CAS 88569-53-3

6-fluoro-1-[methyl(oxido)-lambda~5~-azanyl]-7-(4-methylpiperazin-1-yl)-4-oxo-1,4-dihydroquinoline-3-carboxylic acid

Description:

6-Fluoro-1-[methyl(oxido)-lambda~5~-azanyl]-7-(4-methylpiperazin-1-yl)-4-oxo-1,4-dihydroquinoline-3-carboxylic acid, with CAS number 88569-53-3, is a synthetic compound belonging to the class of quinolone derivatives. This substance is characterized by its complex molecular structure, which includes a fluorine atom, a piperazine moiety, and a carboxylic acid functional group. The presence of the oxido-lambda~5~-azanyl group indicates a nitrogen atom that is part of a five-membered ring system, contributing to its biological activity. The compound is known for its potential pharmacological properties, particularly in the field of antimicrobial and antiviral research. Its structure suggests that it may interact with bacterial enzymes or receptors, making it a candidate for further investigation in drug development. Additionally, the presence of the methyl and piperazine groups may influence its solubility and bioavailability, which are critical factors in pharmacokinetics. Overall, this compound represents a significant area of interest in medicinal chemistry.

Formula: C₁₆H₁₉FN₄O₄

InChI: InChI=1S/C16H19FN4O4/c1-18-20-9-11(16(23)24)15(22)10-7-12(17)14(8-13(10)20)19-3-5-21(2,25)6-4-19/h7-9,18H,3-6H2,1-2H3,(H,23,24)

InChI key: InChIKey=KOHWXWKRVBJAQK-UHFFFAOYSA-N

SMILES: CN1CCN(CC1)c1cc2c(cc1F)c(=O)c(cn2N(=O)C)C(=O)O