CAS 88569-57-7
:6-fluoro-1-(methylamino)-4-oxo-7-(piperazin-1-yl)-1,4-dihydroquinoline-3-carboxylic acid
Description:
6-Fluoro-1-(methylamino)-4-oxo-7-(piperazin-1-yl)-1,4-dihydroquinoline-3-carboxylic acid, with CAS number 88569-57-7, is a synthetic compound that belongs to the class of quinolone derivatives. This substance is characterized by its complex molecular structure, which includes a fluorine atom, a methylamino group, and a piperazine moiety, contributing to its potential biological activity. The presence of the carboxylic acid functional group suggests that it may exhibit acidic properties, influencing its solubility and reactivity in various environments. Quinoline derivatives are often studied for their pharmacological properties, including antibacterial and antiviral activities. The specific arrangement of functional groups in this compound may enhance its interaction with biological targets, making it a subject of interest in medicinal chemistry. Additionally, the fluorine substitution can improve metabolic stability and bioavailability. Overall, this compound represents a unique structure that may have implications in drug development and therapeutic applications.
Formula:C15H17FN4O3
InChI:InChI=1/C15H17FN4O3/c1-17-20-8-10(15(22)23)14(21)9-6-11(16)13(7-12(9)20)19-4-2-18-3-5-19/h6-8,17-18H,2-5H2,1H3,(H,22,23)
SMILES:CNn1cc(c(=O)c2cc(c(cc12)N1CCNCC1)F)C(=O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3-Quinolinecarboxylicacid, 6-fluoro-1,4-dihydro-1-(methylamino)-4-oxo-7-(1-piperazinyl)-
CAS:Formula:C15H17FN4O3Molecular weight:320.3189
