CAS 88569-81-7
:O-naphthalen-2-yl (3-methoxyphenyl)methylcarbamothioate
Description:
O-naphthalen-2-yl (3-methoxyphenyl)methylcarbamothioate, with the CAS number 88569-81-7, is a chemical compound that belongs to the class of carbamothioates, which are derivatives of carbamic acid where the oxygen atom is replaced by a sulfur atom. This compound features a naphthalene moiety and a methoxy-substituted phenyl group, indicating its potential for various applications in organic synthesis and medicinal chemistry. It is characterized by its unique structural framework, which may contribute to its biological activity, possibly as an insecticide or fungicide, although specific biological properties would require further investigation. The presence of the methoxy group suggests enhanced lipophilicity, which can influence its solubility and permeability in biological systems. Additionally, the compound's stability, reactivity, and potential interactions with biological targets would be of interest in pharmacological studies. As with many chemical substances, safety data and handling precautions should be considered when working with this compound in laboratory settings.
Formula:C19H17NO2S
InChI:InChI=1/C19H17NO2S/c1-20(16-8-5-9-17(13-16)21-2)19(23)22-18-11-10-14-6-3-4-7-15(14)12-18/h3-13H,1-2H3
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
N-(3-methoxyphenyl)-N-methyl-1-naphthalen-2-yloxy-methanethioamide
CAS:Formula:C19H17NO2SMolecular weight:323.4088
