CAS 885698-97-5

(2-chloro-4-morpholino-thieno[3,2-d]pyrimidin-6-yl)methanol

Description:

(2-chloro-4-morpholino-thieno[3,2-d]pyrimidin-6-yl)methanol is a chemical compound characterized by its unique structural features, which include a thieno[3,2-d]pyrimidine core, a morpholine ring, and a hydroxymethyl group. The presence of the chlorine atom at the 2-position and the morpholino group at the 4-position contribute to its potential biological activity. This compound is likely to exhibit polar characteristics due to the hydroxymethyl group, which can enhance its solubility in polar solvents. The thieno[3,2-d]pyrimidine framework is known for its relevance in medicinal chemistry, often associated with various pharmacological properties. The morpholine moiety may also impart additional properties, such as increased lipophilicity and the ability to interact with biological targets. Overall, this compound may be of interest in drug development and research, particularly in the fields of oncology or infectious diseases, although specific biological activities would require empirical investigation.

Formula: C₁₁H₁₂ClN₃O₂S

InChI: InChI=1/C11H12ClN3O2S/c12-11-13-8-5-7(6-16)18-9(8)10(14-11)15-1-3-17-4-2-15/h5,16H,1-4,6H2

SMILES: C1COCCN1c1c2c(cc(CO)s2)nc(Cl)n1

(2-Chloro-4-morpholinothieno[3,2-d]pyrimidin-6-yl)methanol

CAS: 885698-97-5

Formula: C₁₁H₁₂ClN₃O₂S

Molecular weight: 285.7499

Ref: IN-DA004DMG