CymitQuimica logo

CAS 885698-98-6

:

6-(Bromomethyl)-2-chloro-4-(4-morpholinyl)thieno[3,2-d]pyrimidine

Description:
6-(Bromomethyl)-2-chloro-4-(4-morpholinyl)thieno[3,2-d]pyrimidine is a heterocyclic compound characterized by its complex structure, which includes a thieno[3,2-d]pyrimidine core. This compound features a bromomethyl group and a chlorine atom, contributing to its reactivity and potential applications in medicinal chemistry. The presence of a morpholine ring enhances its solubility and biological activity, making it a candidate for various pharmaceutical applications. The thieno[3,2-d]pyrimidine framework is known for its role in the development of kinase inhibitors and other therapeutic agents. The compound's molecular structure suggests it may exhibit specific interactions with biological targets, potentially influencing its pharmacological properties. Additionally, its synthesis and characterization involve standard organic chemistry techniques, and it may be subject to further studies to explore its efficacy and safety in biological systems. Overall, this compound represents a significant interest in the field of drug discovery and development.
Formula:C11H11BrClN3OS
InChI:InChI=1S/C11H11BrClN3OS/c12-6-7-5-8-9(18-7)10(15-11(13)14-8)16-1-3-17-4-2-16/h5H,1-4,6H2
InChI key:InChIKey=DDGJOTNSVPHXNT-UHFFFAOYSA-N
SMILES:C(Br)C=1SC2=C(N=C(Cl)N=C2C1)N3CCOCC3
Synonyms:
  • 4-[6-(Bromomethyl)-2-chlorothieno[3,2-d]pyrimidin-4-yl]morpholine
  • Thieno[3,2-d]pyrimidine, 6-(bromomethyl)-2-chloro-4-(4-morpholinyl)-
  • 6-(Bromomethyl)-2-chloro-4-(4-morpholinyl)thieno[3,2-d]pyrimidine
  • 6-(Bromomethyl)-2-chloro-4-(morpholin-4-yl)thieno[3,2-d]pyrimidine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.