CAS 885699-90-1

1-(2-Thiazolylmethyl)piperazine

Description:

1-(2-Thiazolylmethyl)piperazine is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. The thiazole moiety, a five-membered ring containing sulfur and nitrogen, is attached to the piperazine via a methylene bridge. This compound typically exhibits properties such as moderate solubility in polar solvents, which can be attributed to the presence of both the piperazine and thiazole functional groups. It may display biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of the thiazole ring can contribute to its potential as a ligand in various biological interactions. Additionally, the compound may undergo typical reactions associated with piperazine derivatives, such as alkylation or acylation, allowing for further functionalization. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity. Overall, 1-(2-Thiazolylmethyl)piperazine represents a versatile structure in organic synthesis and drug development.

Formula: C₈H₁₃N₃S

InChI: InChI=1S/C8H13N3S/c1-4-11(5-2-9-1)7-8-10-3-6-12-8/h3,6,9H,1-2,4-5,7H2

InChI key: InChIKey=NEPNZBBYKHIRKO-UHFFFAOYSA-N

SMILES: C(N1CCNCC1)C2=NC=CS2

Synonyms:

• 1-(Thiazol-2-ylmethyl)-piperazine
• Piperazine, 1-(2-thiazolylmethyl)-
• 1-(1,3-Thiazol-2-ylmethyl)piperazine
• 1-(2-Thiazolylmethyl)piperazine