CAS 88571-76-0
:Tetrahydro-2-methyl-2H-pyran-4-carbothioamide
Description:
Tetrahydro-2-methyl-2H-pyran-4-carbothioamide is a chemical compound characterized by its unique structure, which includes a tetrahydropyran ring and a carbothioamide functional group. This compound typically exhibits properties associated with both heterocycles and sulfur-containing compounds. It is likely to be a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. The presence of the carbothioamide group suggests potential reactivity, particularly in nucleophilic substitution reactions, and it may participate in various organic synthesis pathways. Additionally, the compound may exhibit moderate polarity due to the functional groups present, influencing its solubility in organic solvents. Its applications could span fields such as pharmaceuticals, agrochemicals, or materials science, where its unique structural features may impart specific biological or chemical properties. As with many chemical substances, safety data sheets should be consulted for handling and toxicity information, as the reactivity and safety profile can vary based on concentration and exposure.
Formula:C7H13NOS
InChI:InChI=1S/C7H13NOS/c1-5-4-6(7(8)10)2-3-9-5/h5-6H,2-4H2,1H3,(H2,8,10)
InChI key:InChIKey=JHARUVYBOXKZPB-UHFFFAOYSA-N
SMILES:C(N)(=S)C1CC(C)OCC1
Synonyms:- 2-Methyltetrahydro-2H-pyran-4-carbothioamide
- 2H-Pyran-4-carbothioamide, tetrahydro-2-methyl-
- Tetrahydro-2-methyl-2H-pyran-4-carbothioamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
