CAS 88572-02-5

N-[4-(Tetrahydro-2H-pyran-4-yl)-2-thiazolyl]acetamide

Description:

N-[4-(Tetrahydro-2H-pyran-4-yl)-2-thiazolyl]acetamide, with the CAS number 88572-02-5, is a chemical compound characterized by its unique structural features, which include a thiazole ring and a tetrahydropyran moiety. This compound typically exhibits properties such as moderate solubility in polar solvents, which is influenced by the presence of both the thiazole and acetamide functional groups. The thiazole ring contributes to its potential biological activity, as thiazoles are often found in various pharmaceuticals and agrochemicals. The tetrahydropyran group may enhance the compound's lipophilicity, affecting its interaction with biological membranes. Additionally, the acetamide functional group can participate in hydrogen bonding, which may influence the compound's reactivity and stability. Overall, this compound's characteristics make it of interest in medicinal chemistry and related fields, where its potential applications could be explored further. However, specific physical and chemical properties such as melting point, boiling point, and spectral data would require experimental determination or literature reference for precise values.

Formula: C₁₀H₁₄N₂O₂S

InChI: InChI=1S/C10H14N2O2S/c1-7(13)11-10-12-9(6-15-10)8-2-4-14-5-3-8/h6,8H,2-5H2,1H3,(H,11,12,13)

InChI key: InChIKey=WHADLIJHMLPCAC-UHFFFAOYSA-N

SMILES: N(C(C)=O)C1=NC(=CS1)C2CCOCC2

Synonyms:

• Acetamide, N-[4-(tetrahydro-2H-pyran-4-yl)-2-thiazolyl]-
• N-[4-(Tetrahydro-2H-pyran-4-yl)-2-thiazolyl]acetamide

Acetamide, N-[4-(tetrahydro-2H-pyran-4-yl)-2-thiazolyl]-

CAS: 88572-02-5

Formula: C₁₀H₁₄N₂O₂S

Molecular weight: 226.2954

Ref: IN-DA004DM2