CymitQuimica logo

CAS 88572-12-7

:

N-[4-(Tetrahydro-2,2-dimethyl-2H-pyran-4-yl)-2-thiazolyl]acetamide

Description:
N-[4-(Tetrahydro-2,2-dimethyl-2H-pyran-4-yl)-2-thiazolyl]acetamide, with the CAS number 88572-12-7, is a chemical compound characterized by its unique structural features, which include a thiazole ring and a tetrahydro-pyran moiety. This compound typically exhibits properties such as moderate solubility in organic solvents and potential biological activity, making it of interest in pharmaceutical research. The presence of the thiazole ring often contributes to its reactivity and interaction with biological targets, while the tetrahydro-pyran structure may influence its pharmacokinetic properties. Additionally, the acetamide functional group can enhance its ability to form hydrogen bonds, which is crucial for its interaction with biological macromolecules. Overall, this compound's characteristics suggest potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. However, specific data regarding its physical properties, reactivity, and biological activity would require further investigation through experimental studies.
Formula:C12H18N2O2S
InChI:InChI=1S/C12H18N2O2S/c1-8(15)13-11-14-10(7-17-11)9-4-5-16-12(2,3)6-9/h7,9H,4-6H2,1-3H3,(H,13,14,15)
InChI key:InChIKey=INWQEMBMIXCGRC-UHFFFAOYSA-N
SMILES:N(C(C)=O)C1=NC(=CS1)C2CC(C)(C)OCC2
Synonyms:
  • Acetamide, N-[4-(tetrahydro-2,2-dimethyl-2H-pyran-4-yl)-2-thiazolyl]-
  • N-[4-(Tetrahydro-2,2-dimethyl-2H-pyran-4-yl)-2-thiazolyl]acetamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.