CAS 88572-22-9
:Tetrahydro-2-methyl-2H-pyran-4-carbonyl chloride
Description:
Tetrahydro-2-methyl-2H-pyran-4-carbonyl chloride, with the CAS number 88572-22-9, is an organic compound characterized by its cyclic structure and the presence of a carbonyl chloride functional group. This compound features a tetrahydropyran ring, which contributes to its stability and reactivity. The carbonyl chloride group indicates that it is a derivative of an acid chloride, making it reactive towards nucleophiles, which is useful in various synthetic applications. The presence of the methyl group at the 2-position of the pyran ring can influence its steric and electronic properties, potentially affecting its reactivity and interactions with other molecules. Typically, compounds like this are utilized in organic synthesis, particularly in the preparation of more complex molecules, including pharmaceuticals and agrochemicals. Due to the presence of the carbonyl chloride, it may also exhibit properties such as being a lachrymator or irritant, necessitating careful handling and storage under appropriate conditions to ensure safety.
Formula:C7H11ClO2
InChI:InChI=1S/C7H11ClO2/c1-5-4-6(7(8)9)2-3-10-5/h5-6H,2-4H2,1H3
InChI key:InChIKey=SHHXPVIGQLZJPS-UHFFFAOYSA-N
SMILES:C(Cl)(=O)C1CC(C)OCC1
Synonyms:- 2H-Pyran-4-carbonyl chloride, tetrahydro-2-methyl-
- 2-Methyloxane-4-carbonyl chloride
- Tetrahydro-2-methyl-2H-pyran-4-carbonyl chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
