CAS 88575-32-0
:{4-[(trifluoromethyl)sulfanyl]phenyl}hydrazine
Description:
{4-[(Trifluoromethyl)sulfanyl]phenyl}hydrazine, with the CAS number 88575-32-0, is an organic compound characterized by the presence of a hydrazine functional group attached to a phenyl ring that is further substituted with a trifluoromethylthio group. This compound typically exhibits properties associated with both hydrazines and aromatic compounds, including potential reactivity due to the hydrazine moiety, which can participate in various chemical reactions such as oxidation and condensation. The trifluoromethyl group contributes to the compound's lipophilicity and can influence its electronic properties, making it of interest in medicinal chemistry and materials science. Additionally, the presence of sulfur in the form of a thioether can impart unique characteristics, such as increased stability and potential for further functionalization. Overall, this compound may be utilized in research settings for its potential applications in pharmaceuticals or as a building block in organic synthesis. Safety precautions should be observed due to the toxicity often associated with hydrazine derivatives.
Formula:C7H7F3N2S
InChI:InChI=1/C7H7F3N2S/c8-7(9,10)13-6-3-1-5(12-11)2-4-6/h1-4,12H,11H2
SMILES:c1cc(ccc1NN)SC(F)(F)F
Synonyms:- {4-[(Trifluormethyl)sulfanyl]phenyl}hydrazin
- Hydrazine, [4-[(Trifluoromethyl)Thio]Phenyl]-
- {4-[(Trifluoromethyl)sulfanyl]phenyl}hydrazine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
