CAS 88575-38-6

2-Hydroxyethyl 4-(2-benzoxazolyl)benzoate

Description:

2-Hydroxyethyl 4-(2-benzoxazolyl)benzoate, with the CAS number 88575-38-6, is an organic compound characterized by its ester functional group and the presence of a benzoxazole moiety. This compound typically exhibits a white to off-white crystalline appearance and is soluble in organic solvents, such as ethanol and acetone, while being less soluble in water. The presence of the hydroxyethyl group contributes to its hydrophilicity, which can influence its interactions in various chemical environments. It is often utilized in applications such as UV absorbers, stabilizers, or as intermediates in organic synthesis due to its ability to absorb ultraviolet light. The benzoxazole ring system is known for its fluorescent properties, making this compound potentially useful in photonic applications. Additionally, its chemical stability and reactivity can be tailored through modifications of the substituents on the aromatic rings, allowing for a range of functional applications in materials science and pharmaceuticals.

Formula: C₁₆H₁₃NO₄

InChI: InChI=1S/C16H13NO4/c18-9-10-20-16(19)12-7-5-11(6-8-12)15-17-13-3-1-2-4-14(13)21-15/h1-8,18H,9-10H2

InChI key: InChIKey=OQWRAAAYBQYTLY-UHFFFAOYSA-N

SMILES: C(OCCO)(=O)C1=CC=C(C2=NC=3C(O2)=CC=CC3)C=C1

Synonyms:

• Benzoic acid, 4-(2-benzoxazolyl)-, 2-hydroxyethyl ester
• 2-Hydroxyethyl 4-(2-benzoxazolyl)benzoate

Benzoic acid, 4-(2-benzoxazolyl)-, 2-hydroxyethyl ester

CAS: 88575-38-6

Formula: C₁₆H₁₃NO₄

Molecular weight: 283.2787

Ref: IN-DA004DLV