CymitQuimica logo

CAS 88576-97-0

:

Glycine, N-[N-[(phenylamino)carbonyl]-L-leucyl]-

Description:
Glycine, N-[N-[(phenylamino)carbonyl]-L-leucyl]- is a synthetic compound that belongs to the class of peptides. It is characterized by its structure, which includes a glycine residue linked to a phenylamino carbonyl group and an L-leucyl moiety. This compound is notable for its potential applications in biochemistry and pharmaceuticals, particularly in the development of peptide-based drugs. The presence of the phenyl group contributes to its hydrophobic characteristics, while the glycine and leucine residues provide flexibility and stability to the peptide chain. The compound may exhibit specific biological activities, including potential roles in signaling pathways or as a building block for more complex peptides. Its solubility and reactivity can vary based on the pH and the presence of other functional groups. As with many peptides, its synthesis and purification require careful consideration of conditions to maintain structural integrity and biological activity. Overall, this compound exemplifies the complexity and utility of peptide chemistry in various scientific fields.
Formula:C15H21N3O4
InChI:InChI=1S/C15H21N3O4/c1-10(2)8-12(14(21)16-9-13(19)20)18-15(22)17-11-6-4-3-5-7-11/h3-7,10,12H,8-9H2,1-2H3,(H,16,21)(H,19,20)(H2,17,18,22)/t12-/m0/s1
InChI key:InChIKey=FVOKZQDAILJTJG-LBPRGKRZSA-N
SMILES:[C@@H](NC(NC1=CC=CC=C1)=O)(C(NCC(O)=O)=O)CC(C)C
Synonyms:
  • Glycine, N-[N-[(phenylamino)carbonyl]-L-leucyl]-
  • Glycine, N-(N-phenylcarbamylleucyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.